Table 1.

Chemical formula of the SFN analogues used

Chemical nameCommon nameChemical formula
3-(Methylthio)-propyl isothiocyanateIberverinCH3-S-(CH2)3-N=C=S
4-(Methylthio)-butyl isothiocyanateErucinCH3-S-(CH2)4-N=C=S
5-(Methylthio)-pentyl isothiocyanateBerteroinCH3-S-(CH2)5-N=C=S
3-(Methylsulfinyl)-propyl isothiocyanateIberinCH3-SO-(CH2)3-N=C=S
4-(Methylsulfinyl)-butyl isothiocyanateSulforaphaneCH3-SO-(CH2)4-N=C=S
5-(Methylsulfinyl)-pentyl isothiocyanateAlyssinCH3-SO-(CH2)5-N=C=S
3-(Methylsulfonyl)-propyl isothiocyanateCheirolinCH3-SO2-(CH2)3-N=C=S
4-(Methylsulfonyl)-butyl isothiocyanateErysolinCH3-SO2-(CH2)4-N=C=S
5-(Methylsulfonyl)-pentyl isothiocyanateAlyssin sulfoneCH3-SO2-(CH2)5-N=C=S